C17H18N4O3 — CID 55377471
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 55377471) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 55377471 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-3-9-20(10-4-2)16(22)11-24-17(23)14-5-7-15(8-6-14)21-13-18-12-19-21/h3-8,12-13H,1-2,9-11H2 |
| InChIKey | XFNQMEWPVCBIBT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|