C13H16N2O3 — CID 114028551
ethyl 2-methyl-4-(pent-4-ynoylamino)-1H-pyrrole-3-carboxylate (PubChem CID 114028551) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl 2-methyl-4-(pent-4-ynoylamino)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-(pent-4-ynoylamino)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 114028551 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | ethyl 2-methyl-4-(pent-4-ynoylamino)-1H-pyrrole-3-carboxylate |
| SMILES | C#CCCC(=O)Nc1c[nH]c(C)c1C(=O)OCC |
| InChI | InChI=1S/C13H16N2O3/c1-4-6-7-11(16)15-10-8-14-9(3)12(10)13(17)18-5-2/h1,8,14H,5-7H2,2-3H3,(H,15,16) |
| InChIKey | FMWDSRDTILNERE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|