C13H22N2O4S — CID 82881335
ethyl 2-methyl-4-(3-methylbutylsulfonylamino)-1H-pyrrole-3-carboxylate (PubChem CID 82881335) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is ethyl 2-methyl-4-(3-methylbutylsulfonylamino)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-(3-methylbutylsulfonylamino)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 82881335 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethyl 2-methyl-4-(3-methylbutylsulfonylamino)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(NS(=O)(=O)CCC(C)C)c[nH]c1C |
| InChI | InChI=1S/C13H22N2O4S/c1-5-19-13(16)12-10(4)14-8-11(12)15-20(17,18)7-6-9(2)3/h8-9,14-15H,5-7H2,1-4H3 |
| InChIKey | SFXUMUKVVQSUSY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |