About 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid
1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid (PubChem CID 67830511) has the molecular formula C22H36N2O4Sn
and a molecular weight of 511.25 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid |
| PubChem CID | 67830511 |
| Molecular Formula | C22H36N2O4Sn |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CN(N2C(=O)CCC2=O)CC(C(=O)O)=C1 |
| InChI | InChI=1S/C10H9N2O4.3C4H9.Sn/c13-8-3-4-9(14)12(8)11-5-1-2-7(6-11)10(15)16;3*1-3-4-2;/h2,5H,3-4,6H2,(H,15,16);3*1,3-4H2,2H3; |
| InChIKey | LEHSMJCSRRWJSF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid?
The IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid (CID 67830511) is 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid.
What is the SMILES notation for 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid?
The canonical SMILES for 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid is CCCC[Sn](CCCC)(CCCC)C1=CN(N2C(=O)CCC2=O)CC(C(=O)O)=C1.
What is the InChIKey of 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid?
The InChIKey is LEHSMJCSRRWJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2O4.3C4H9.Sn/c13-8-3-4-9(14)12(8)11-5-1-2-7(6-11)10(15)16;3*1-3-4-2;/h2,5H,3-4,6H2,(H,15,16);3*1,3-4H2,2H3;.
What are the key properties of 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid?
1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid has a molecular weight of 511.25 g/mol, XLogP of 4.65, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dioxopyrrolidin-1-yl)-5-tributylstannyl-2H-pyridine-3-carboxylic acid is sourced from PubChem (CID 67830511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).