About 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid
2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid (PubChem CID 19967724) has the molecular formula C25H38N2O5Sn
and a molecular weight of 565.30 g/mol. Its IUPAC name is 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid |
| PubChem CID | 19967724 |
| Molecular Formula | C25H38N2O5Sn |
| Molecular Weight | 565.30 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C(=O)N(CC(=O)O)N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H11N2O5.3C4H9.Sn/c16-10-6-7-11(17)15(10)14(8-12(18)19)13(20)9-4-2-1-3-5-9;3*1-3-4-2;/h2-5H,6-8H2,(H,18,19);3*1,3-4H2,2H3; |
| InChIKey | UHQDCRSMYAEDPK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid?
The IUPAC name of 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid (CID 19967724) is 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid.
What is the SMILES notation for 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid?
The canonical SMILES for 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid is CCCC[Sn](CCCC)(CCCC)c1ccc(C(=O)N(CC(=O)O)N2C(=O)CCC2=O)cc1.
What is the InChIKey of 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid?
The InChIKey is UHQDCRSMYAEDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N2O5.3C4H9.Sn/c16-10-6-7-11(17)15(10)14(8-12(18)19)13(20)9-4-2-1-3-5-9;3*1-3-4-2;/h2-5H,6-8H2,(H,18,19);3*1,3-4H2,2H3;.
What are the key properties of 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid?
2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid has a molecular weight of 565.30 g/mol, XLogP of 4.33, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dioxopyrrolidin-1-yl)-(4-tributylstannylbenzoyl)amino]acetic acid is sourced from PubChem (CID 19967724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).