C21H37NOSn — CID 22420961
N,N-dimethyl-3-tributylstannylbenzamide (PubChem CID 22420961) has the molecular formula C21H37NOSn and a molecular weight of 438.24 g/mol. Its IUPAC name is N,N-dimethyl-3-tributylstannylbenzamide.
| Compound Name | N,N-dimethyl-3-tributylstannylbenzamide |
|---|---|
| PubChem CID | 22420961 |
| Molecular Formula | C21H37NOSn |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N,N-dimethyl-3-tributylstannylbenzamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C9H10NO.3C4H9.Sn/c1-10(2)9(11)8-6-4-3-5-7-8;3*1-3-4-2;/h3-4,6-7H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | QGSYIYMWIFUHCV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |