C17H26N2O2 — CID 109055821
1-N-butyl-3-N,3-N-diethyl-1-N-methylbenzene-1,3-dicarboxamide (PubChem CID 109055821) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-N-butyl-3-N,3-N-diethyl-1-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N,3-N-diethyl-1-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055821 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-N-butyl-3-N,3-N-diethyl-1-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CCCCN(C)C(=O)c1cccc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-5-8-12-18(4)16(20)14-10-9-11-15(13-14)17(21)19(6-2)7-3/h9-11,13H,5-8,12H2,1-4H3 |
| InChIKey | HPPOVQXQIIPETL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |