C16H22N2O2 — CID 109050938
3-N-butyl-3-N-methyl-1-N-prop-2-enylbenzene-1,3-dicarboxamide (PubChem CID 109050938) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-N-butyl-3-N-methyl-1-N-prop-2-enylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-butyl-3-N-methyl-1-N-prop-2-enylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109050938 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-N-butyl-3-N-methyl-1-N-prop-2-enylbenzene-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)c1cccc(C(=O)N(C)CCCC)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-4-6-11-18(3)16(20)14-9-7-8-13(12-14)15(19)17-10-5-2/h5,7-9,12H,2,4,6,10-11H2,1,3H3,(H,17,19) |
| InChIKey | RJYHNOTXEKAFID-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|