C23H41NOSn — CID 67913040
N-(3-tributylstannylphenyl)pentanamide (PubChem CID 67913040) has the molecular formula C23H41NOSn and a molecular weight of 466.30 g/mol. Its IUPAC name is N-(3-tributylstannylphenyl)pentanamide.
| Compound Name | N-(3-tributylstannylphenyl)pentanamide |
|---|---|
| PubChem CID | 67913040 |
| Molecular Formula | C23H41NOSn |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-(3-tributylstannylphenyl)pentanamide |
| SMILES | CCCCC(=O)Nc1cccc([Sn](CCCC)(CCCC)CCCC)c1 |
| InChI | InChI=1S/C11H14NO.3C4H9.Sn/c1-2-3-9-11(13)12-10-7-5-4-6-8-10;3*1-3-4-2;/h4-5,7-8H,2-3,9H2,1H3,(H,12,13);3*1,3-4H2,2H3; |
| InChIKey | RVCVMUAIEZIKTB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |