C22H39N3O2Sn — CID 70601105
1-(propanoylamino)-3-(3-tributylstannylphenyl)urea (PubChem CID 70601105) has the molecular formula C22H39N3O2Sn and a molecular weight of 496.28 g/mol. Its IUPAC name is 1-(propanoylamino)-3-(3-tributylstannylphenyl)urea.
| Compound Name | 1-(propanoylamino)-3-(3-tributylstannylphenyl)urea |
|---|---|
| PubChem CID | 70601105 |
| Molecular Formula | C22H39N3O2Sn |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-(propanoylamino)-3-(3-tributylstannylphenyl)urea |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(NC(=O)NNC(=O)CC)c1 |
| InChI | InChI=1S/C10H12N3O2.3C4H9.Sn/c1-2-9(14)12-13-10(15)11-8-6-4-3-5-7-8;3*1-3-4-2;/h3-4,6-7H,2H2,1H3,(H,12,14)(H2,11,13,15);3*1,3-4H2,2H3; |
| InChIKey | RVEGNYFJKBBQLF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|