C25H39NO4Sn — CID 19967726
2-(2,5-dioxopyrrolidin-1-yl)-3-(4-tributylstannylphenyl)propanoic acid (PubChem CID 19967726) has the molecular formula C25H39NO4Sn and a molecular weight of 536.30 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-3-(4-tributylstannylphenyl)propanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(4-tributylstannylphenyl)propanoic acid |
|---|---|
| PubChem CID | 19967726 |
| Molecular Formula | C25H39NO4Sn |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(4-tributylstannylphenyl)propanoic acid |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(CC(C(=O)O)N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H12NO4.3C4H9.Sn/c15-11-6-7-12(16)14(11)10(13(17)18)8-9-4-2-1-3-5-9;3*1-3-4-2;/h2-5,10H,6-8H2,(H,17,18);3*1,3-4H2,2H3; |
| InChIKey | GVBIJUWFPINECW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|