C13H11Cl2NO4 — CID 140569768
3-(2,3-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)propanoic acid (PubChem CID 140569768) has the molecular formula C13H11Cl2NO4 and a molecular weight of 316.14 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)propanoic acid.
| Compound Name | 3-(2,3-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 140569768 |
| Molecular Formula | C13H11Cl2NO4 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Cl)c1Cl)N1C(=O)CCC1=O |
| InChI | InChI=1S/C13H11Cl2NO4/c14-8-3-1-2-7(12(8)15)6-9(13(19)20)16-10(17)4-5-11(16)18/h1-3,9H,4-6H2,(H,19,20) |
| InChIKey | CKLPRSXPUNZAOO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|