3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid

C13H10Cl2O2S — CID 83954863

IUPAC3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1Cl)c1cccs1
InChIInChI=1S/C13H10Cl2O2S/c14-10-4-1-3-8(12(10)15)7-9(13(16)17)11-5-2-6-18-11/h1-6,9H,7H2,(H,16,17)
InChIKeyQBEIJYQCKKFDBA-UHFFFAOYSA-N
MW301.19 g/mol
LogP4.47
Rot. Bonds4

About 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid

3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid (PubChem CID 83954863) has the molecular formula C13H10Cl2O2S and a molecular weight of 301.19 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid.

Molecular Properties

Compound Name3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid
PubChem CID83954863
Molecular FormulaC13H10Cl2O2S
Molecular Weight301.19 g/mol
Exact Mass299.98
IUPAC Name3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1Cl)c1cccs1
InChIInChI=1S/C13H10Cl2O2S/c14-10-4-1-3-8(12(10)15)7-9(13(16)17)11-5-2-6-18-11/h1-6,9H,7H2,(H,16,17)
InChIKeyQBEIJYQCKKFDBA-UHFFFAOYSA-N
XLogP4.47
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.19
LogP ≤ 54.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid?
The IUPAC name of 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid (CID 83954863) is 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid.
What is the SMILES notation for 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid?
The canonical SMILES for 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid is O=C(O)C(Cc1cccc(Cl)c1Cl)c1cccs1.
What is the InChIKey of 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid?
The InChIKey is QBEIJYQCKKFDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2O2S/c14-10-4-1-3-8(12(10)15)7-9(13(16)17)11-5-2-6-18-11/h1-6,9H,7H2,(H,16,17).
What are the key properties of 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid?
3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid has a molecular weight of 301.19 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dichlorophenyl)-2-thiophen-2-ylpropanoic acid is sourced from PubChem (CID 83954863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).