C15H11Cl3O2 — CID 107307183
2-(2-chlorophenyl)-3-(2,3-dichlorophenyl)propanoic acid (PubChem CID 107307183) has the molecular formula C15H11Cl3O2 and a molecular weight of 329.61 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(2,3-dichlorophenyl)propanoic acid.
| Compound Name | 2-(2-chlorophenyl)-3-(2,3-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 107307183 |
| Molecular Formula | C15H11Cl3O2 |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(2,3-dichlorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Cl)c1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl3O2/c16-12-6-2-1-5-10(12)11(15(19)20)8-9-4-3-7-13(17)14(9)18/h1-7,11H,8H2,(H,19,20) |
| InChIKey | PNHGZFABLMYIDB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |