C15H11Cl2FO2 — CID 103038733
3-(3-chloro-4-fluorophenyl)-2-(2-chlorophenyl)propanoic acid (PubChem CID 103038733) has the molecular formula C15H11Cl2FO2 and a molecular weight of 313.16 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-2-(2-chlorophenyl)propanoic acid.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-2-(2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 103038733 |
| Molecular Formula | C15H11Cl2FO2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-2-(2-chlorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(F)c(Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl2FO2/c16-12-4-2-1-3-10(12)11(15(19)20)7-9-5-6-14(18)13(17)8-9/h1-6,8,11H,7H2,(H,19,20) |
| InChIKey | MSUKDMHOZBSQTE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |