C12H15ClO2 — CID 79019167
2-(2-chlorophenyl)-4-methylpentanoic acid (PubChem CID 79019167) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-methylpentanoic acid.
| Compound Name | 2-(2-chlorophenyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 79019167 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(2-chlorophenyl)-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClO2/c1-8(2)7-10(12(14)15)9-5-3-4-6-11(9)13/h3-6,8,10H,7H2,1-2H3,(H,14,15) |
| InChIKey | ZOBWLWMTGCMGJB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |