C16H14ClNO3 — CID 170945297
3-benzamido-2-(2-chlorophenyl)propanoic acid (PubChem CID 170945297) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 3-benzamido-2-(2-chlorophenyl)propanoic acid.
| Compound Name | 3-benzamido-2-(2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 170945297 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-benzamido-2-(2-chlorophenyl)propanoic acid |
| SMILES | O=C(NCC(C(=O)O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H14ClNO3/c17-14-9-5-4-8-12(14)13(16(20)21)10-18-15(19)11-6-2-1-3-7-11/h1-9,13H,10H2,(H,18,19)(H,20,21) |
| InChIKey | KTWVWGJGVUAUPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |