C22H24N2O8 — CID 160944738
butanoic acid;2-(2,5-dioxopyrrolidin-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid (PubChem CID 160944738) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is butanoic acid;2-(2,5-dioxopyrrolidin-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid.
| Compound Name | butanoic acid;2-(2,5-dioxopyrrolidin-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 160944738 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | butanoic acid;2-(2,5-dioxopyrrolidin-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
| SMILES | CCCC(=O)O.O=C(O)C(CCc1ccc(N2C(=O)C=CC2=O)cc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C18H16N2O6.C4H8O2/c21-14-7-8-15(22)19(14)12-4-1-11(2-5-12)3-6-13(18(25)26)20-16(23)9-10-17(20)24;1-2-3-4(5)6/h1-2,4-5,7-8,13H,3,6,9-10H2,(H,25,26);2-3H2,1H3,(H,5,6) |
| InChIKey | SUYTUFLUYKXMBA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|