C19H27NO5 — CID 58960805
6-phenyl-N-[(1S,4R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]hexanamide (PubChem CID 58960805) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 6-phenyl-N-[(1S,4R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]hexanamide.
| Compound Name | 6-phenyl-N-[(1S,4R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]hexanamide |
|---|---|
| PubChem CID | 58960805 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 6-phenyl-N-[(1S,4R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]hexanamide |
| SMILES | O=C(CCCCCc1ccccc1)N[C@H]1C=C(CO)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C19H27NO5/c21-12-14-11-15(18(24)19(25)17(14)23)20-16(22)10-6-2-5-9-13-7-3-1-4-8-13/h1,3-4,7-8,11,15,17-19,21,23-25H,2,5-6,9-10,12H2,(H,20,22)/t15-,17+,18-,19?/m0/s1 |
| InChIKey | KRBQSQUWONQKMB-WSQYJPPESA-N |
| XLogP | 0.29 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|