C14H25NO9 — CID 10689257
(1S,2S,3R,6S)-6-[[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 10689257) has the molecular formula C14H25NO9 and a molecular weight of 351.35 g/mol. Its IUPAC name is (1S,2S,3R,6S)-6-[[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R,6S)-6-[[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 10689257 |
| Molecular Formula | C14H25NO9 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (1S,2S,3R,6S)-6-[[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H25NO9/c1-23-14-8(12(21)11(20)7(4-17)24-14)15-6-2-5(3-16)9(18)13(22)10(6)19/h2,6-22H,3-4H2,1H3/t6-,7+,8+,9+,10-,11+,12+,13-,14-/m0/s1 |
| InChIKey | WAGIOGQBBUKFQD-WWXYIRFGSA-N |
| XLogP | -4.59 |
| TPSA | 172.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|