C20H35NO14 — CID 15916677
2-(hydroxymethyl)-6-[2,3,5-trihydroxy-6-(hydroxymethyl)-4-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxyoxane-3,4,5-triol (PubChem CID 15916677) has the molecular formula C20H35NO14 and a molecular weight of 513.49 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[2,3,5-trihydroxy-6-(hydroxymethyl)-4-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxyoxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[2,3,5-trihydroxy-6-(hydroxymethyl)-4-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 15916677 |
| Molecular Formula | C20H35NO14 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 2-(hydroxymethyl)-6-[2,3,5-trihydroxy-6-(hydroxymethyl)-4-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxyoxane-3,4,5-triol |
| SMILES | OCC1=CC(NC2C(O)C(O)C(OC3OC(CO)C(O)C(O)C3O)C(CO)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C20H35NO14/c22-2-5-1-7(12(27)15(30)10(5)25)21-9-11(26)6(3-23)19(17(32)14(9)29)35-20-18(33)16(31)13(28)8(4-24)34-20/h1,6-33H,2-4H2 |
| InChIKey | QYKWCMVFBWGYRE-UHFFFAOYSA-N |
| XLogP | -7.78 |
| TPSA | 273.25 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | -7.78 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|