C18H33NO7Si — CID 25149480
[(4aR,7R,8R,8aS)-7-acetamido-2,2-ditert-butyl-6-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate (PubChem CID 25149480) has the molecular formula C18H33NO7Si and a molecular weight of 403.55 g/mol. Its IUPAC name is [(4aR,7R,8R,8aS)-7-acetamido-2,2-ditert-butyl-6-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate.
| Compound Name | [(4aR,7R,8R,8aS)-7-acetamido-2,2-ditert-butyl-6-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
|---|---|
| PubChem CID | 25149480 |
| Molecular Formula | C18H33NO7Si |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [(4aR,7R,8R,8aS)-7-acetamido-2,2-ditert-butyl-6-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
| SMILES | CC(=O)N[C@H]1C(O)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H33NO7Si/c1-10(20)19-13-15(24-11(2)21)14-12(25-16(13)22)9-23-27(26-14,17(3,4)5)18(6,7)8/h12-16,22H,9H2,1-8H3,(H,19,20)/t12-,13-,14-,15-,16?/m1/s1 |
| InChIKey | LQTUMWAEIRLPCV-XIHUBIEQSA-N |
| XLogP | 1.60 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|