C24H37N6O15P — CID 91560804
[(3R,4R,6R)-4-acetyloxy-5-azido-6-[[(3S,4R,6S)-3,4-diacetyloxy-5-azido-6-propoxyoxan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-ethyloxan-3-yl] acetate (PubChem CID 91560804) has the molecular formula C24H37N6O15P and a molecular weight of 680.56 g/mol. Its IUPAC name is [(3R,4R,6R)-4-acetyloxy-5-azido-6-[[(3S,4R,6S)-3,4-diacetyloxy-5-azido-6-propoxyoxan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-ethyloxan-3-yl] acetate.
| Compound Name | [(3R,4R,6R)-4-acetyloxy-5-azido-6-[[(3S,4R,6S)-3,4-diacetyloxy-5-azido-6-propoxyoxan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-ethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 91560804 |
| Molecular Formula | C24H37N6O15P |
| Molecular Weight | 680.56 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | [(3R,4R,6R)-4-acetyloxy-5-azido-6-[[(3S,4R,6S)-3,4-diacetyloxy-5-azido-6-propoxyoxan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-ethyloxan-3-yl] acetate |
| SMILES | CCCO[C@H]1OC(COP(=O)(O)O[C@H]2OC(CC)[C@@H](OC(C)=O)[C@H](OC(C)=O)C2N=[N+]=[N-])[C@@H](OC(C)=O)[C@H](OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C24H37N6O15P/c1-7-9-37-23-17(27-29-25)21(41-13(5)33)20(40-12(4)32)16(44-23)10-38-46(35,36)45-24-18(28-30-26)22(42-14(6)34)19(39-11(3)31)15(8-2)43-24/h15-24H,7-10H2,1-6H3,(H,35,36)/t15?,16?,17?,18?,19-,20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | WKIVQUBIOGKBIC-KMWSQSGFSA-N |
| XLogP | 2.49 |
| TPSA | 286.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|