C12H25BrO3Si — CID 101120407
ethyl (2S,3R)-2-bromo-2,4-dimethyl-3-trimethylsilyloxypentanoate (PubChem CID 101120407) has the molecular formula C12H25BrO3Si and a molecular weight of 325.32 g/mol. Its IUPAC name is ethyl (2S,3R)-2-bromo-2,4-dimethyl-3-trimethylsilyloxypentanoate.
| Compound Name | ethyl (2S,3R)-2-bromo-2,4-dimethyl-3-trimethylsilyloxypentanoate |
|---|---|
| PubChem CID | 101120407 |
| Molecular Formula | C12H25BrO3Si |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | ethyl (2S,3R)-2-bromo-2,4-dimethyl-3-trimethylsilyloxypentanoate |
| SMILES | CCOC(=O)[C@@](C)(Br)[C@H](O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C12H25BrO3Si/c1-8-15-11(14)12(4,13)10(9(2)3)16-17(5,6)7/h9-10H,8H2,1-7H3/t10-,12+/m1/s1 |
| InChIKey | YEGMMNITVSFHQB-PWSUYJOCSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|