C11H23NO3Si — CID 102418289
tert-butyl-dimethyl-[(E,2S)-4-nitropent-3-en-2-yl]oxysilane (PubChem CID 102418289) has the molecular formula C11H23NO3Si and a molecular weight of 245.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-4-nitropent-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-4-nitropent-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 102418289 |
| Molecular Formula | C11H23NO3Si |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-4-nitropent-3-en-2-yl]oxysilane |
| SMILES | C/C(=C\[C@H](C)O[Si](C)(C)C(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C11H23NO3Si/c1-9(12(13)14)8-10(2)15-16(6,7)11(3,4)5/h8,10H,1-7H3/b9-8+/t10-/m0/s1 |
| InChIKey | CJHIJYJISYYUPO-DDXVTDLHSA-N |
| XLogP | 3.58 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|