C9H16BrNO2 — CID 60873203
methyl 2-(2-bromoprop-2-enylamino)-3-methylbutanoate (PubChem CID 60873203) has the molecular formula C9H16BrNO2 and a molecular weight of 250.14 g/mol. Its IUPAC name is methyl 2-(2-bromoprop-2-enylamino)-3-methylbutanoate.
| Compound Name | methyl 2-(2-bromoprop-2-enylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 60873203 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | methyl 2-(2-bromoprop-2-enylamino)-3-methylbutanoate |
| SMILES | C=C(Br)CNC(C(=O)OC)C(C)C |
| InChI | InChI=1S/C9H16BrNO2/c1-6(2)8(9(12)13-4)11-5-7(3)10/h6,8,11H,3,5H2,1-2,4H3 |
| InChIKey | FFIHWLRTRFNQMX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |