C12H22N2O6 — CID 66002819
3-hydroxy-4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 66002819) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-hydroxy-4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3-methylbutanoic acid.
| Compound Name | 3-hydroxy-4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002819 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-hydroxy-4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | COC(=O)C(NC(=O)NCC(C)(O)CC(=O)O)C(C)C |
| InChI | InChI=1S/C12H22N2O6/c1-7(2)9(10(17)20-4)14-11(18)13-6-12(3,19)5-8(15)16/h7,9,19H,5-6H2,1-4H3,(H,15,16)(H2,13,14,18) |
| InChIKey | CWTIAOGKKUFGSN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |