C12H24N2O4 — CID 66001833
4-(hexan-2-ylcarbamoylamino)-3-hydroxy-3-methylbutanoic acid (PubChem CID 66001833) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-(hexan-2-ylcarbamoylamino)-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-(hexan-2-ylcarbamoylamino)-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66001833 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 4-(hexan-2-ylcarbamoylamino)-3-hydroxy-3-methylbutanoic acid |
| SMILES | CCCCC(C)NC(=O)NCC(C)(O)CC(=O)O |
| InChI | InChI=1S/C12H24N2O4/c1-4-5-6-9(2)14-11(17)13-8-12(3,18)7-10(15)16/h9,18H,4-8H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | UCXABUWVLKYJSG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |