C8H20ClN3O — CID 171647987
(2S)-2-(3-aminopropylamino)-3-methylbutanamide;hydrochloride (PubChem CID 171647987) has the molecular formula C8H20ClN3O and a molecular weight of 209.72 g/mol. Its IUPAC name is (2S)-2-(3-aminopropylamino)-3-methylbutanamide;hydrochloride.
| Compound Name | (2S)-2-(3-aminopropylamino)-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 171647987 |
| Molecular Formula | C8H20ClN3O |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (2S)-2-(3-aminopropylamino)-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)[C@H](NCCCN)C(N)=O.Cl |
| InChI | InChI=1S/C8H19N3O.ClH/c1-6(2)7(8(10)12)11-5-3-4-9;/h6-7,11H,3-5,9H2,1-2H3,(H2,10,12);1H/t7-;/m0./s1 |
| InChIKey | DIGQOGWSQXJVKM-FJXQXJEOSA-N |
| XLogP | -0.14 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|