C11H19NO3 — CID 120684446
4-(2,4-dimethylpent-4-enoylamino)butanoic acid (PubChem CID 120684446) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(2,4-dimethylpent-4-enoylamino)butanoic acid.
| Compound Name | 4-(2,4-dimethylpent-4-enoylamino)butanoic acid |
|---|---|
| PubChem CID | 120684446 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 4-(2,4-dimethylpent-4-enoylamino)butanoic acid |
| SMILES | C=C(C)CC(C)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C11H19NO3/c1-8(2)7-9(3)11(15)12-6-4-5-10(13)14/h9H,1,4-7H2,2-3H3,(H,12,15)(H,13,14) |
| InChIKey | DEMCMXBOXRMMSQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|