C9H15F3N2O5 — CID 175163069
4-(2-aminopropanoylamino)butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 175163069) has the molecular formula C9H15F3N2O5 and a molecular weight of 288.22 g/mol. Its IUPAC name is 4-(2-aminopropanoylamino)butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2-aminopropanoylamino)butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175163069 |
| Molecular Formula | C9H15F3N2O5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(2-aminopropanoylamino)butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(N)C(=O)NCCCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H14N2O3.C2HF3O2/c1-5(8)7(12)9-4-2-3-6(10)11;3-2(4,5)1(6)7/h5H,2-4,8H2,1H3,(H,9,12)(H,10,11);(H,6,7) |
| InChIKey | GTTKKRPFYQCRLD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|