C12H21NO3 — CID 120687904
3-(2,4-dimethylpent-4-enoylamino)-2,2-dimethylpropanoic acid (PubChem CID 120687904) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-(2,4-dimethylpent-4-enoylamino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2,4-dimethylpent-4-enoylamino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 120687904 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(2,4-dimethylpent-4-enoylamino)-2,2-dimethylpropanoic acid |
| SMILES | C=C(C)CC(C)C(=O)NCC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H21NO3/c1-8(2)6-9(3)10(14)13-7-12(4,5)11(15)16/h9H,1,6-7H2,2-5H3,(H,13,14)(H,15,16) |
| InChIKey | UIBGCVOPOPDJRQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|