C10H18N2O3 — CID 114618034
2,2-dimethyl-3-(2-methylprop-2-enylcarbamoylamino)propanoic acid (PubChem CID 114618034) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methylprop-2-enylcarbamoylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(2-methylprop-2-enylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114618034 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2,2-dimethyl-3-(2-methylprop-2-enylcarbamoylamino)propanoic acid |
| SMILES | C=C(C)CNC(=O)NCC(C)(C)C(=O)O |
| InChI | InChI=1S/C10H18N2O3/c1-7(2)5-11-9(15)12-6-10(3,4)8(13)14/h1,5-6H2,2-4H3,(H,13,14)(H2,11,12,15) |
| InChIKey | OYJUDGSMEWABOC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|