4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid

C12H21NO3 — CID 120689729

IUPAC4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid
SMILESC=C(C)CC(C)C(=O)NCC(C)CC(=O)O
InChIInChI=1S/C12H21NO3/c1-8(2)5-10(4)12(16)13-7-9(3)6-11(14)15/h9-10H,1,5-7H2,2-4H3,(H,13,16)(H,14,15)
InChIKeySABDSWPBRZBBIG-UHFFFAOYSA-N
MW227.30 g/mol
LogP1.82
Rot. Bonds7

About 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid

4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid (PubChem CID 120689729) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid.

Molecular Properties

Compound Name4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid
PubChem CID120689729
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Name4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid
SMILESC=C(C)CC(C)C(=O)NCC(C)CC(=O)O
InChIInChI=1S/C12H21NO3/c1-8(2)5-10(4)12(16)13-7-9(3)6-11(14)15/h9-10H,1,5-7H2,2-4H3,(H,13,16)(H,14,15)
InChIKeySABDSWPBRZBBIG-UHFFFAOYSA-N
XLogP1.82
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid?
The IUPAC name of 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid (CID 120689729) is 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid.
What is the SMILES notation for 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid?
The canonical SMILES for 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid is C=C(C)CC(C)C(=O)NCC(C)CC(=O)O.
What is the InChIKey of 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid?
The InChIKey is SABDSWPBRZBBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8(2)5-10(4)12(16)13-7-9(3)6-11(14)15/h9-10H,1,5-7H2,2-4H3,(H,13,16)(H,14,15).
What are the key properties of 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid?
4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid has a molecular weight of 227.30 g/mol, XLogP of 1.82, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylpent-4-enoylamino)-3-methylbutanoic acid is sourced from PubChem (CID 120689729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).