About 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene
2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene (PubChem CID 175620074) has the molecular formula C15H25F
and a molecular weight of 224.36 g/mol. Its IUPAC name is 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene.
Molecular Properties
| Compound Name | 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene |
| PubChem CID | 175620074 |
| Molecular Formula | C15H25F |
| Molecular Weight | 224.36 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene |
| SMILES | C=C(C)CC(C(=C)C(C)C)C(C)CC(=C)F |
| InChI | InChI=1S/C15H25F/c1-10(2)8-15(14(7)11(3)4)12(5)9-13(6)16/h11-12,15H,1,6-9H2,2-5H3 |
| InChIKey | MEGHOLVPKWWKHM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene?
The IUPAC name of 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene (CID 175620074) is 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene.
What is the SMILES notation for 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene?
The canonical SMILES for 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene is C=C(C)CC(C(=C)C(C)C)C(C)CC(=C)F.
What is the InChIKey of 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene?
The InChIKey is MEGHOLVPKWWKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25F/c1-10(2)8-15(14(7)11(3)4)12(5)9-13(6)16/h11-12,15H,1,6-9H2,2-5H3.
What are the key properties of 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene?
2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene has a molecular weight of 224.36 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,7-dimethyl-5-(3-methylbut-1-en-2-yl)octa-1,7-diene is sourced from PubChem (CID 175620074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).