About 2,3-dimethylbutane;bis(sulfanediol)
2,3-dimethylbutane;bis(sulfanediol) (PubChem CID 119097400) has the molecular formula C6H18O4S2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,3-dimethylbutane;bis(sulfanediol).
Molecular Properties
| Compound Name | 2,3-dimethylbutane;bis(sulfanediol) |
| PubChem CID | 119097400 |
| Molecular Formula | C6H18O4S2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2,3-dimethylbutane;bis(sulfanediol) |
| SMILES | CC(C)C(C)C.OSO.OSO |
| InChI | InChI=1S/C6H14.2H2O2S/c1-5(2)6(3)4;2*1-3-2/h5-6H,1-4H3;2*1-2H |
| InChIKey | RAXUADQLDRKCSY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane;bis(sulfanediol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;bis(sulfanediol)?
The IUPAC name of 2,3-dimethylbutane;bis(sulfanediol) (CID 119097400) is 2,3-dimethylbutane;bis(sulfanediol).
What is the SMILES notation for 2,3-dimethylbutane;bis(sulfanediol)?
The canonical SMILES for 2,3-dimethylbutane;bis(sulfanediol) is CC(C)C(C)C.OSO.OSO.
What is the InChIKey of 2,3-dimethylbutane;bis(sulfanediol)?
The InChIKey is RAXUADQLDRKCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.2H2O2S/c1-5(2)6(3)4;2*1-3-2/h5-6H,1-4H3;2*1-2H.
What are the key properties of 2,3-dimethylbutane;bis(sulfanediol)?
2,3-dimethylbutane;bis(sulfanediol) has a molecular weight of 218.34 g/mol, XLogP of 3.63, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;bis(sulfanediol) is sourced from PubChem (CID 119097400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).