About propane;N-propan-2-ylpentan-3-amine
propane;N-propan-2-ylpentan-3-amine (PubChem CID 144761250) has the molecular formula C11H27N
and a molecular weight of 173.34 g/mol. Its IUPAC name is propane;N-propan-2-ylpentan-3-amine.
Molecular Properties
| Compound Name | propane;N-propan-2-ylpentan-3-amine |
| PubChem CID | 144761250 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | propane;N-propan-2-ylpentan-3-amine |
| SMILES | CCC.CCC(CC)NC(C)C |
| InChI | InChI=1S/C8H19N.C3H8/c1-5-8(6-2)9-7(3)4;1-3-2/h7-9H,5-6H2,1-4H3;3H2,1-2H3 |
| InChIKey | GDVKHJLQUZOMTQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propane;N-propan-2-ylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;N-propan-2-ylpentan-3-amine?
The IUPAC name of propane;N-propan-2-ylpentan-3-amine (CID 144761250) is propane;N-propan-2-ylpentan-3-amine.
What is the SMILES notation for propane;N-propan-2-ylpentan-3-amine?
The canonical SMILES for propane;N-propan-2-ylpentan-3-amine is CCC.CCC(CC)NC(C)C.
What is the InChIKey of propane;N-propan-2-ylpentan-3-amine?
The InChIKey is GDVKHJLQUZOMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H8/c1-5-8(6-2)9-7(3)4;1-3-2/h7-9H,5-6H2,1-4H3;3H2,1-2H3.
What are the key properties of propane;N-propan-2-ylpentan-3-amine?
propane;N-propan-2-ylpentan-3-amine has a molecular weight of 173.34 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;N-propan-2-ylpentan-3-amine is sourced from PubChem (CID 144761250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).