About lithium;azanide;N-propan-2-ylpropan-2-amine
lithium;azanide;N-propan-2-ylpropan-2-amine (PubChem CID 172803690) has the molecular formula C6H17LiN2
and a molecular weight of 124.16 g/mol. Its IUPAC name is lithium;azanide;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | lithium;azanide;N-propan-2-ylpropan-2-amine |
| PubChem CID | 172803690 |
| Molecular Formula | C6H17LiN2 |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.16 |
| IUPAC Name | lithium;azanide;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.[Li+].[NH2-] |
| InChI | InChI=1S/C6H15N.Li.H2N/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;;1H2/q;+1;-1 |
| InChIKey | RFEWRMUDABTUBZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 45.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;azanide;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;azanide;N-propan-2-ylpropan-2-amine?
The IUPAC name of lithium;azanide;N-propan-2-ylpropan-2-amine (CID 172803690) is lithium;azanide;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for lithium;azanide;N-propan-2-ylpropan-2-amine?
The canonical SMILES for lithium;azanide;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.[Li+].[NH2-].
What is the InChIKey of lithium;azanide;N-propan-2-ylpropan-2-amine?
The InChIKey is RFEWRMUDABTUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Li.H2N/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;;1H2/q;+1;-1.
What are the key properties of lithium;azanide;N-propan-2-ylpropan-2-amine?
lithium;azanide;N-propan-2-ylpropan-2-amine has a molecular weight of 124.16 g/mol, XLogP of -0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;azanide;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 172803690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).