C10H21F3O2Si — CID 173041526
di(propan-2-yloxy)-(3,4,4-trifluorobutan-2-yl)silane (PubChem CID 173041526) has the molecular formula C10H21F3O2Si and a molecular weight of 258.36 g/mol. Its IUPAC name is di(propan-2-yloxy)-(3,4,4-trifluorobutan-2-yl)silane.
| Compound Name | di(propan-2-yloxy)-(3,4,4-trifluorobutan-2-yl)silane |
|---|---|
| PubChem CID | 173041526 |
| Molecular Formula | C10H21F3O2Si |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | di(propan-2-yloxy)-(3,4,4-trifluorobutan-2-yl)silane |
| SMILES | CC(C)O[SiH](OC(C)C)C(C)C(F)C(F)F |
| InChI | InChI=1S/C10H21F3O2Si/c1-6(2)14-16(15-7(3)4)8(5)9(11)10(12)13/h6-10,16H,1-5H3 |
| InChIKey | VQKXQYMNUHAPPO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|