About di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane
di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane (PubChem CID 173041525) has the molecular formula C10H21F3O2Si
and a molecular weight of 258.36 g/mol. Its IUPAC name is di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane.
Molecular Properties
| Compound Name | di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane |
| PubChem CID | 173041525 |
| Molecular Formula | C10H21F3O2Si |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane |
| SMILES | CC(C)O[SiH](OC(C)C)C(C)CC(F)(F)F |
| InChI | InChI=1S/C10H21F3O2Si/c1-7(2)14-16(15-8(3)4)9(5)6-10(11,12)13/h7-9,16H,6H2,1-5H3 |
| InChIKey | HCURBFHQBDRCHF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane?
The IUPAC name of di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane (CID 173041525) is di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane.
What is the SMILES notation for di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane?
The canonical SMILES for di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane is CC(C)O[SiH](OC(C)C)C(C)CC(F)(F)F.
What is the InChIKey of di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane?
The InChIKey is HCURBFHQBDRCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3O2Si/c1-7(2)14-16(15-8(3)4)9(5)6-10(11,12)13/h7-9,16H,6H2,1-5H3.
What are the key properties of di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane?
di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane has a molecular weight of 258.36 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yloxy)-(4,4,4-trifluorobutan-2-yl)silane is sourced from PubChem (CID 173041525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).