C10H21F3O2Si — CID 22020734
tert-butyl-dimethoxy-(4,4,4-trifluorobutan-2-yl)silane (PubChem CID 22020734) has the molecular formula C10H21F3O2Si and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl-dimethoxy-(4,4,4-trifluorobutan-2-yl)silane.
| Compound Name | tert-butyl-dimethoxy-(4,4,4-trifluorobutan-2-yl)silane |
|---|---|
| PubChem CID | 22020734 |
| Molecular Formula | C10H21F3O2Si |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | tert-butyl-dimethoxy-(4,4,4-trifluorobutan-2-yl)silane |
| SMILES | CO[Si](OC)(C(C)CC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C10H21F3O2Si/c1-8(7-10(11,12)13)16(14-5,15-6)9(2,3)4/h8H,7H2,1-6H3 |
| InChIKey | IDQYZGFSQQEKAH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|