C9H18F3NO — CID 115922978
3-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol (PubChem CID 115922978) has the molecular formula C9H18F3NO and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol.
| Compound Name | 3-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 115922978 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
| SMILES | CC(CC(F)(F)F)NC(C)(C)C(C)O |
| InChI | InChI=1S/C9H18F3NO/c1-6(5-9(10,11)12)13-8(3,4)7(2)14/h6-7,13-14H,5H2,1-4H3 |
| InChIKey | JQBGOJHRQVWKQC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |