About 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene
3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene (PubChem CID 123767607) has the molecular formula C7H10F4
and a molecular weight of 170.15 g/mol. Its IUPAC name is 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene |
| PubChem CID | 123767607 |
| Molecular Formula | C7H10F4 |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene |
| SMILES | C=CC(C(F)F)C(C)C(F)F |
| InChI | InChI=1S/C7H10F4/c1-3-5(7(10)11)4(2)6(8)9/h3-7H,1H2,2H3 |
| InChIKey | DSHYJPXTTJEFCQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene?
The IUPAC name of 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene (CID 123767607) is 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene.
What is the SMILES notation for 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene?
The canonical SMILES for 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene is C=CC(C(F)F)C(C)C(F)F.
What is the InChIKey of 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene?
The InChIKey is DSHYJPXTTJEFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F4/c1-3-5(7(10)11)4(2)6(8)9/h3-7H,1H2,2H3.
What are the key properties of 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene?
3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene has a molecular weight of 170.15 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-5,5-difluoro-4-methylpent-1-ene is sourced from PubChem (CID 123767607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).