C8H8Br2F4O — CID 141435557
1-bromo-1-(1-bromo-4,4-difluorobut-2-enoxy)-4,4-difluorobut-2-ene (PubChem CID 141435557) has the molecular formula C8H8Br2F4O and a molecular weight of 355.95 g/mol. Its IUPAC name is 1-bromo-1-(1-bromo-4,4-difluorobut-2-enoxy)-4,4-difluorobut-2-ene.
| Compound Name | 1-bromo-1-(1-bromo-4,4-difluorobut-2-enoxy)-4,4-difluorobut-2-ene |
|---|---|
| PubChem CID | 141435557 |
| Molecular Formula | C8H8Br2F4O |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 1-bromo-1-(1-bromo-4,4-difluorobut-2-enoxy)-4,4-difluorobut-2-ene |
| SMILES | FC(F)C=CC(Br)OC(Br)C=CC(F)F |
| InChI | InChI=1S/C8H8Br2F4O/c9-5(1-3-7(11)12)15-6(10)2-4-8(13)14/h1-8H |
| InChIKey | GJIGJFDUAJCVRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|