About 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene
1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene (PubChem CID 173077751) has the molecular formula C6H6Br4O
and a molecular weight of 413.73 g/mol. Its IUPAC name is 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene.
Molecular Properties
| Compound Name | 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene |
| PubChem CID | 173077751 |
| Molecular Formula | C6H6Br4O |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 409.72 |
| IUPAC Name | 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene |
| SMILES | BrC=CC(Br)OC(Br)C=CBr |
| InChI | InChI=1S/C6H6Br4O/c7-3-1-5(9)11-6(10)2-4-8/h1-6H |
| InChIKey | RGBKGRDAGKLIAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene?
The IUPAC name of 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene (CID 173077751) is 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene.
What is the SMILES notation for 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene?
The canonical SMILES for 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene is BrC=CC(Br)OC(Br)C=CBr.
What is the InChIKey of 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene?
The InChIKey is RGBKGRDAGKLIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Br4O/c7-3-1-5(9)11-6(10)2-4-8/h1-6H.
What are the key properties of 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene?
1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene has a molecular weight of 413.73 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-3-(1,3-dibromoprop-2-enoxy)prop-1-ene is sourced from PubChem (CID 173077751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).