C2H2Br2Cl2 — CID 98044589
(1R,2R)-1,2-dibromo-1,2-dichloroethane (PubChem CID 98044589) has the molecular formula C2H2Br2Cl2 and a molecular weight of 256.75 g/mol. Its IUPAC name is (1R,2R)-1,2-dibromo-1,2-dichloroethane.
| Compound Name | (1R,2R)-1,2-dibromo-1,2-dichloroethane |
|---|---|
| PubChem CID | 98044589 |
| Molecular Formula | C2H2Br2Cl2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 253.79 |
| IUPAC Name | (1R,2R)-1,2-dibromo-1,2-dichloroethane |
| SMILES | Cl[C@H](Br)[C@H](Cl)Br |
| InChI | InChI=1S/C2H2Br2Cl2/c3-1(5)2(4)6/h1-2H/t1-,2-/m0/s1 |
| InChIKey | RJMDFMUPJANPGX-LWMBPPNESA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|