About 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene
1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene (PubChem CID 125476010) has the molecular formula C9H7BrF2
and a molecular weight of 233.06 g/mol. Its IUPAC name is 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene |
| PubChem CID | 125476010 |
| Molecular Formula | C9H7BrF2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene |
| SMILES | FC(F)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrF2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,9H/b6-3+ |
| InChIKey | HQJIDHJLMXGTFZ-ZZXKWVIFSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene?
The IUPAC name of 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene (CID 125476010) is 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene.
What is the SMILES notation for 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene?
The canonical SMILES for 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene is FC(F)/C=C/c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene?
The InChIKey is HQJIDHJLMXGTFZ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C9H7BrF2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,9H/b6-3+.
What are the key properties of 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene?
1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene has a molecular weight of 233.06 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene is sourced from PubChem (CID 125476010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).