C9H7BrF2 — CID 125476010
1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene (PubChem CID 125476010) has the molecular formula C9H7BrF2 and a molecular weight of 233.06 g/mol. Its IUPAC name is 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene.
| Compound Name | 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 125476010 |
| Molecular Formula | C9H7BrF2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 1-bromo-4-[(E)-3,3-difluoroprop-1-enyl]benzene |
| SMILES | FC(F)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrF2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,9H/b6-3+ |
| InChIKey | HQJIDHJLMXGTFZ-ZZXKWVIFSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |