C10H8BrCl3O — CID 125476149
(E,2R)-4-(4-bromophenyl)-1,1,1-trichlorobut-3-en-2-ol (PubChem CID 125476149) has the molecular formula C10H8BrCl3O and a molecular weight of 330.44 g/mol. Its IUPAC name is (E,2R)-4-(4-bromophenyl)-1,1,1-trichlorobut-3-en-2-ol.
| Compound Name | (E,2R)-4-(4-bromophenyl)-1,1,1-trichlorobut-3-en-2-ol |
|---|---|
| PubChem CID | 125476149 |
| Molecular Formula | C10H8BrCl3O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 327.88 |
| IUPAC Name | (E,2R)-4-(4-bromophenyl)-1,1,1-trichlorobut-3-en-2-ol |
| SMILES | O[C@H](/C=C/c1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8BrCl3O/c11-8-4-1-7(2-5-8)3-6-9(15)10(12,13)14/h1-6,9,15H/b6-3+/t9-/m1/s1 |
| InChIKey | CRXXKZFRBIHPIC-BSPAPZMXSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|