C19H17BrO2 — CID 67161057
4-(4-bromophenyl)-2-methyl-6-phenylhexa-2,5-dienoic acid (PubChem CID 67161057) has the molecular formula C19H17BrO2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-methyl-6-phenylhexa-2,5-dienoic acid.
| Compound Name | 4-(4-bromophenyl)-2-methyl-6-phenylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 67161057 |
| Molecular Formula | C19H17BrO2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 4-(4-bromophenyl)-2-methyl-6-phenylhexa-2,5-dienoic acid |
| SMILES | CC(=CC(C=Cc1ccccc1)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C19H17BrO2/c1-14(19(21)22)13-17(16-9-11-18(20)12-10-16)8-7-15-5-3-2-4-6-15/h2-13,17H,1H3,(H,21,22) |
| InChIKey | XRIAQYAOJIBYNK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|