C16H16BrN — CID 150387945
4-bromo-N-[(E,2S)-4-phenylbut-3-en-2-yl]aniline (PubChem CID 150387945) has the molecular formula C16H16BrN and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-bromo-N-[(E,2S)-4-phenylbut-3-en-2-yl]aniline.
| Compound Name | 4-bromo-N-[(E,2S)-4-phenylbut-3-en-2-yl]aniline |
|---|---|
| PubChem CID | 150387945 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-bromo-N-[(E,2S)-4-phenylbut-3-en-2-yl]aniline |
| SMILES | C[C@@H](/C=C/c1ccccc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrN/c1-13(7-8-14-5-3-2-4-6-14)18-16-11-9-15(17)10-12-16/h2-13,18H,1H3/b8-7+/t13-/m0/s1 |
| InChIKey | HBCBCDBXZVMHTH-GWJCSSMESA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |